About [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum
[(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum (PubChem CID 58517826) has the molecular formula C15H17N2OPPt
and a molecular weight of 467.37 g/mol. Its IUPAC name is [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum.
Molecular Properties
| Compound Name | [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
| PubChem CID | 58517826 |
| Molecular Formula | C15H17N2OPPt |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
| SMILES | C[PH+](C)/C=C\O.[Pt].[c-]1cccc2ccn3ccnc3c12 |
| InChI | InChI=1S/C11H7N2.C4H9OP.Pt/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-6(2)4-3-5;/h1-3,5-8H;3-5H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | FHOJRBIHPBHSRJ-LWFKIUJUSA-O |
| XLogP | 3.77 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum?
The IUPAC name of [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum (CID 58517826) is [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum.
What is the SMILES notation for [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum?
The canonical SMILES for [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum is C[PH+](C)/C=C\O.[Pt].[c-]1cccc2ccn3ccnc3c12.
What is the InChIKey of [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum?
The InChIKey is FHOJRBIHPBHSRJ-LWFKIUJUSA-O. The full InChI is InChI=1S/C11H7N2.C4H9OP.Pt/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-6(2)4-3-5;/h1-3,5-8H;3-5H,1-2H3;/q-1;;/p+1/b;4-3-;.
What are the key properties of [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum?
[(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum has a molecular weight of 467.37 g/mol, XLogP of 3.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-hydroxyethenyl]-dimethylphosphanium;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum is sourced from PubChem (CID 58517826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).