C12H9N2Pt- — CID 58517743
6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide;platinum (PubChem CID 58517743) has the molecular formula C12H9N2Pt- and a molecular weight of 376.30 g/mol. Its IUPAC name is 6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide;platinum.
| Compound Name | 6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
|---|---|
| PubChem CID | 58517743 |
| Molecular Formula | C12H9N2Pt- |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
| SMILES | Cc1cn2ccnc2c2[c-]cccc12.[Pt] |
| InChI | InChI=1S/C12H9N2.Pt/c1-9-8-14-7-6-13-12(14)11-5-3-2-4-10(9)11;/h2-4,6-8H,1H3;/q-1; |
| InChIKey | GACUKABVIDIIRJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|