C11H12N2 — CID 12899030
1-(cyclohepta-1,3,5-trien-1-ylmethyl)imidazole (PubChem CID 12899030) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(cyclohepta-1,3,5-trien-1-ylmethyl)imidazole.
| Compound Name | 1-(cyclohepta-1,3,5-trien-1-ylmethyl)imidazole |
|---|---|
| PubChem CID | 12899030 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-(cyclohepta-1,3,5-trien-1-ylmethyl)imidazole |
| SMILES | C1=CC=C(Cn2ccnc2)CC=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-4-6-11(5-3-1)9-13-8-7-12-10-13/h1-5,7-8,10H,6,9H2 |
| InChIKey | ZHBMROCKZGDCRU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |