C14H19FN2 — CID 142149368
2-[(3E,5Z)-3-fluoro-7-methylnona-1,3,5-trien-2-yl]-1-methylimidazole (PubChem CID 142149368) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(3E,5Z)-3-fluoro-7-methylnona-1,3,5-trien-2-yl]-1-methylimidazole.
| Compound Name | 2-[(3E,5Z)-3-fluoro-7-methylnona-1,3,5-trien-2-yl]-1-methylimidazole |
|---|---|
| PubChem CID | 142149368 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(3E,5Z)-3-fluoro-7-methylnona-1,3,5-trien-2-yl]-1-methylimidazole |
| SMILES | C=C(/C(F)=C\C=C/C(C)CC)c1nccn1C |
| InChI | InChI=1S/C14H19FN2/c1-5-11(2)7-6-8-13(15)12(3)14-16-9-10-17(14)4/h6-11H,3,5H2,1-2,4H3/b7-6-,13-8+ |
| InChIKey | ZTZYCKIGCCCSSI-ONVRAGQBSA-N |
| XLogP | 3.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|