About 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+)
2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) (PubChem CID 58519217) has the molecular formula C16H28N2O5Pt
and a molecular weight of 523.49 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+).
Molecular Properties
| Compound Name | 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) |
| PubChem CID | 58519217 |
| Molecular Formula | C16H28N2O5Pt |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) |
| SMILES | CCC(C)(C)C(=O)NC(C(=O)O)C(=O)O.[CH2-]C1CCCCC1[NH-].[Pt+2] |
| InChI | InChI=1S/C9H15NO5.C7H13N.Pt/c1-4-9(2,3)8(15)10-5(6(11)12)7(13)14;1-6-4-2-3-5-7(6)8;/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14);6-8H,1-5H2;/q;-2;+2 |
| InChIKey | OJMPLMFBSVDPIK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+)?
The IUPAC name of 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) (CID 58519217) is 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+).
What is the SMILES notation for 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+)?
The canonical SMILES for 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) is CCC(C)(C)C(=O)NC(C(=O)O)C(=O)O.[CH2-]C1CCCCC1[NH-].[Pt+2].
What is the InChIKey of 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+)?
The InChIKey is OJMPLMFBSVDPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO5.C7H13N.Pt/c1-4-9(2,3)8(15)10-5(6(11)12)7(13)14;1-6-4-2-3-5-7(6)8;/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14);6-8H,1-5H2;/q;-2;+2.
What are the key properties of 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+)?
2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) has a molecular weight of 523.49 g/mol, XLogP of 2.51, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylbutanoylamino)propanedioic acid;(2-methanidylcyclohexyl)azanide;platinum(2+) is sourced from PubChem (CID 58519217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).