C35H27F3N4O3 — CID 58524988
1-[4-(2-oxo-2-piperidin-1-ylethoxy)-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 58524988) has the molecular formula C35H27F3N4O3 and a molecular weight of 608.62 g/mol. Its IUPAC name is 1-[4-(2-oxo-2-piperidin-1-ylethoxy)-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-[4-(2-oxo-2-piperidin-1-ylethoxy)-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58524988 |
| Molecular Formula | C35H27F3N4O3 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 1-[4-(2-oxo-2-piperidin-1-ylethoxy)-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | O=C(COc1ccc(-n2c(=O)ccc3cnc4ccc(-c5cnc6ccccc6c5)cc4c32)cc1C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C35H27F3N4O3/c36-35(37,38)28-18-26(10-12-31(28)45-21-33(44)41-14-4-1-5-15-41)42-32(43)13-9-24-19-40-30-11-8-22(17-27(30)34(24)42)25-16-23-6-2-3-7-29(23)39-20-25/h2-3,6-13,16-20H,1,4-5,14-15,21H2 |
| InChIKey | GEZJMBFWLWDEGO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|