C39H35F3N6O2 — CID 58525200
1-[4-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 58525200) has the molecular formula C39H35F3N6O2 and a molecular weight of 676.74 g/mol. Its IUPAC name is 1-[4-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-[4-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58525200 |
| Molecular Formula | C39H35F3N6O2 |
| Molecular Weight | 676.74 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 1-[4-[4-(1-methylpiperidine-4-carbonyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | CN1CCC(C(=O)N2CCN(c3ccc(-n4c(=O)ccc5cnc6ccc(-c7cnc8ccccc8c7)cc6c54)cc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C39H35F3N6O2/c1-45-14-12-25(13-15-45)38(50)47-18-16-46(17-19-47)35-10-8-30(22-32(35)39(40,41)42)48-36(49)11-7-28-23-44-34-9-6-26(21-31(34)37(28)48)29-20-27-4-2-3-5-33(27)43-24-29/h2-11,20-25H,12-19H2,1H3 |
| InChIKey | FIIXPLYFGGMMCT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|