C39H31F3N6O2 — CID 58525215
9-(3-methyl-2H-indazol-5-yl)-1-[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 58525215) has the molecular formula C39H31F3N6O2 and a molecular weight of 672.71 g/mol. Its IUPAC name is 9-(3-methyl-2H-indazol-5-yl)-1-[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(3-methyl-2H-indazol-5-yl)-1-[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58525215 |
| Molecular Formula | C39H31F3N6O2 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 9-(3-methyl-2H-indazol-5-yl)-1-[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | Cc1[nH]nc2ccc(-c3ccc4ncc5ccc(=O)n(-c6ccc(-c7ccc(C(=O)N8CCN(C)CC8)cc7)c(C(F)(F)F)c6)c5c4c3)cc12 |
| InChI | InChI=1S/C39H31F3N6O2/c1-23-31-19-26(8-13-35(31)45-44-23)27-7-12-34-32(20-27)37-28(22-43-34)9-14-36(49)48(37)29-10-11-30(33(21-29)39(40,41)42)24-3-5-25(6-4-24)38(50)47-17-15-46(2)16-18-47/h3-14,19-22H,15-18H2,1-2H3,(H,44,45) |
| InChIKey | XPHFVJJBOKLDPA-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|