C23H22F3O2S+ — CID 58527727
1-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]naphthalen-1-yl]thiolan-1-ium (PubChem CID 58527727) has the molecular formula C23H22F3O2S+ and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]naphthalen-1-yl]thiolan-1-ium.
| Compound Name | 1-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]naphthalen-1-yl]thiolan-1-ium |
|---|---|
| PubChem CID | 58527727 |
| Molecular Formula | C23H22F3O2S+ |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-[4-[2-[4-(trifluoromethyl)phenoxy]ethoxy]naphthalen-1-yl]thiolan-1-ium |
| SMILES | FC(F)(F)c1ccc(OCCOc2ccc([S+]3CCCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H22F3O2S/c24-23(25,26)17-7-9-18(10-8-17)27-13-14-28-21-11-12-22(29-15-3-4-16-29)20-6-2-1-5-19(20)21/h1-2,5-12H,3-4,13-16H2/q+1 |
| InChIKey | PQYIBIOZERZELW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|