C33H33ClN8O4S2 — CID 58528251
2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-cyano-3-isocyano-4-pyridinyl]phenoxy]ethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]acetate (PubChem CID 58528251) has the molecular formula C33H33ClN8O4S2 and a molecular weight of 705.27 g/mol. Its IUPAC name is 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-cyano-3-isocyano-4-pyridinyl]phenoxy]ethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]acetate.
| Compound Name | 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-cyano-3-isocyano-4-pyridinyl]phenoxy]ethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]acetate |
|---|---|
| PubChem CID | 58528251 |
| Molecular Formula | C33H33ClN8O4S2 |
| Molecular Weight | 705.27 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | 2-[4-[2-amino-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-5-cyano-3-isocyano-4-pyridinyl]phenoxy]ethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]acetate |
| SMILES | [C-]#[N+]c1c(N)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccc(OCCOC(=O)CNC(=O)[C@@H](N)CCCCN)cc1 |
| InChI | InChI=1S/C33H33ClN8O4S2/c1-39-29-28(20-7-11-24(12-8-20)45-14-15-46-27(43)17-40-31(44)26(37)4-2-3-13-35)25(16-36)33(42-30(29)38)48-19-23-18-47-32(41-23)21-5-9-22(34)10-6-21/h5-12,18,26H,2-4,13-15,17,19,35,37H2,(H2,38,42)(H,40,44)/t26-/m0/s1 |
| InChIKey | SKWMXPVSBLCWHH-SANMLTNESA-N |
| XLogP | 5.32 |
| TPSA | 196.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.27 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|