C33H34ClN7O3S2 — CID 59435635
2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-cyano-5-isocyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate (PubChem CID 59435635) has the molecular formula C33H34ClN7O3S2 and a molecular weight of 676.27 g/mol. Its IUPAC name is 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-cyano-5-isocyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate.
| Compound Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-cyano-5-isocyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 59435635 |
| Molecular Formula | C33H34ClN7O3S2 |
| Molecular Weight | 676.27 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | 2-[4-[2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3-cyano-5-isocyano-6-(propylamino)-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate |
| SMILES | [C-]#[N+]c1c(NCCC)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccc(OCCOC(=O)[C@@H](N)CCCN)cc1 |
| InChI | InChI=1S/C33H34ClN7O3S2/c1-3-15-39-30-29(38-2)28(21-8-12-25(13-9-21)43-16-17-44-33(42)27(37)5-4-14-35)26(18-36)32(41-30)46-20-24-19-45-31(40-24)22-6-10-23(34)11-7-22/h6-13,19,27H,3-5,14-17,20,35,37H2,1H3,(H,39,41)/t27-/m0/s1 |
| InChIKey | MTATYMNRHOSPIS-MHZLTWQESA-N |
| XLogP | 7.05 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.27 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|