C29H26ClN5O3S2 — CID 59435671
2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(2-ethoxyethylamino)-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyanopyridine-3-carbonitrile (PubChem CID 59435671) has the molecular formula C29H26ClN5O3S2 and a molecular weight of 592.15 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(2-ethoxyethylamino)-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyanopyridine-3-carbonitrile.
| Compound Name | 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(2-ethoxyethylamino)-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyanopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59435671 |
| Molecular Formula | C29H26ClN5O3S2 |
| Molecular Weight | 592.15 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(2-ethoxyethylamino)-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyanopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(NCCOCC)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C29H26ClN5O3S2/c1-3-37-14-12-33-27-26(32-2)25(19-6-10-23(11-7-19)38-15-13-36)24(16-31)29(35-27)40-18-22-17-39-28(34-22)20-4-8-21(30)9-5-20/h4-11,17,36H,3,12-15,18H2,1H3,(H,33,35) |
| InChIKey | RDSSTSCFAHLPNA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.15 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|