C23H49N7O+2 — CID 58529161
triethyl-[[1-[(E)-N'-[N-methyl-N-[4-(4-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium (PubChem CID 58529161) has the molecular formula C23H49N7O+2 and a molecular weight of 439.69 g/mol. Its IUPAC name is triethyl-[[1-[(E)-N'-[N-methyl-N-[4-(4-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium.
| Compound Name | triethyl-[[1-[(E)-N'-[N-methyl-N-[4-(4-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 58529161 |
| Molecular Formula | C23H49N7O+2 |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.40 |
| IUPAC Name | triethyl-[[1-[(E)-N'-[N-methyl-N-[4-(4-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium |
| SMILES | [H]/N=C(\N=C(/N)N1CCCC1C[N+](CC)(CC)CC)N(C)CCCC[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C23H49N7O/c1-6-30(7-2,8-3)20-21-12-11-14-28(21)23(25)26-22(24)27(4)13-9-10-15-29(5)16-18-31-19-17-29/h21H,6-20H2,1-5H3,(H3,24,25,26)/q+2 |
| InChIKey | DGPPUBJLHHEFLO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|