C25H53N7O+2 — CID 123323406
triethyl-[[1-[N'-[N-[2-ethyl-4-(4-methylmorpholin-4-ium-4-yl)butyl]-N-methylcarbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium (PubChem CID 123323406) has the molecular formula C25H53N7O+2 and a molecular weight of 467.75 g/mol. Its IUPAC name is triethyl-[[1-[N'-[N-[2-ethyl-4-(4-methylmorpholin-4-ium-4-yl)butyl]-N-methylcarbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium.
| Compound Name | triethyl-[[1-[N'-[N-[2-ethyl-4-(4-methylmorpholin-4-ium-4-yl)butyl]-N-methylcarbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 123323406 |
| Molecular Formula | C25H53N7O+2 |
| Molecular Weight | 467.75 g/mol |
| Exact Mass | 467.43 |
| IUPAC Name | triethyl-[[1-[N'-[N-[2-ethyl-4-(4-methylmorpholin-4-ium-4-yl)butyl]-N-methylcarbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium |
| SMILES | [H]/N=C(\N=C(N)N1CCCC1C[N+](CC)(CC)CC)N(C)CC(CC)CC[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C25H53N7O/c1-7-22(13-15-31(6)16-18-33-19-17-31)20-29(5)24(26)28-25(27)30-14-11-12-23(30)21-32(8-2,9-3)10-4/h22-23H,7-21H2,1-6H3,(H3,26,27,28)/q+2 |
| InChIKey | ULTLVXPITRGWTD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|