C25H23ClF4N4O2S — CID 58530860
(1E)-1-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 58530860) has the molecular formula C25H23ClF4N4O2S and a molecular weight of 555.00 g/mol. Its IUPAC name is (1E)-1-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (1E)-1-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530860 |
| Molecular Formula | C25H23ClF4N4O2S |
| Molecular Weight | 555.00 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | (1E)-1-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[(3S,4S)-3-fluoro-1-methylpiperidin-4-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CC[C@H](N2C(=O)C/S(=C\c3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)C2=O)[C@@H](F)C1 |
| InChI | InChI=1S/C25H23ClF4N4O2S/c1-32-7-6-22(20(27)12-32)34-23(35)14-37(24(34)36)13-15-2-5-21-17(8-15)10-31-33(21)11-16-3-4-18(26)9-19(16)25(28,29)30/h2-5,8-10,13,20,22H,6-7,11-12,14H2,1H3/t20-,22-,37?/m0/s1 |
| InChIKey | TVONNBUOTUYBHT-RCVQXHNPSA-N |
| XLogP | 5.18 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|