C22H17F2NO3 — CID 58531415
3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-5-(2-hydroxyacetyl)benzamide (PubChem CID 58531415) has the molecular formula C22H17F2NO3 and a molecular weight of 381.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-5-(2-hydroxyacetyl)benzamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-5-(2-hydroxyacetyl)benzamide |
|---|---|
| PubChem CID | 58531415 |
| Molecular Formula | C22H17F2NO3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-5-(2-hydroxyacetyl)benzamide |
| SMILES | O=C(CO)c1cc(C(=O)NCc2ccc(F)cc2)cc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H17F2NO3/c23-19-5-1-14(2-6-19)12-25-22(28)18-10-16(9-17(11-18)21(27)13-26)15-3-7-20(24)8-4-15/h1-11,26H,12-13H2,(H,25,28) |
| InChIKey | AQWDQQHYMDWGGM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |