C18H13F2NO4 — CID 86580227
6-fluoro-N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-1H-naphthalene-1-carboxamide (PubChem CID 86580227) has the molecular formula C18H13F2NO4 and a molecular weight of 345.30 g/mol. Its IUPAC name is 6-fluoro-N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-1H-naphthalene-1-carboxamide.
| Compound Name | 6-fluoro-N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-1H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 86580227 |
| Molecular Formula | C18H13F2NO4 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 6-fluoro-N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-1H-naphthalene-1-carboxamide |
| SMILES | O=C1c2cc(F)ccc2C(C(=O)NCc2ccc(F)cc2)C(=O)C1O |
| InChI | InChI=1S/C18H13F2NO4/c19-10-3-1-9(2-4-10)8-21-18(25)14-12-6-5-11(20)7-13(12)15(22)17(24)16(14)23/h1-7,14,17,24H,8H2,(H,21,25) |
| InChIKey | LCVYMHBOTZOBPQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|