C19H13F4NO4 — CID 86580256
N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-6-(trifluoromethyl)-1H-naphthalene-1-carboxamide (PubChem CID 86580256) has the molecular formula C19H13F4NO4 and a molecular weight of 395.31 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-6-(trifluoromethyl)-1H-naphthalene-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-6-(trifluoromethyl)-1H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 86580256 |
| Molecular Formula | C19H13F4NO4 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2,4-dioxo-6-(trifluoromethyl)-1H-naphthalene-1-carboxamide |
| SMILES | O=C1c2cc(C(F)(F)F)ccc2C(C(=O)NCc2ccc(F)cc2)C(=O)C1O |
| InChI | InChI=1S/C19H13F4NO4/c20-11-4-1-9(2-5-11)8-24-18(28)14-12-6-3-10(19(21,22)23)7-13(12)15(25)17(27)16(14)26/h1-7,14,17,27H,8H2,(H,24,28) |
| InChIKey | QKBAMAGMRDPZGE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|