C24H24FNO5 — CID 152609042
8-acetyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 152609042) has the molecular formula C24H24FNO5 and a molecular weight of 425.46 g/mol. Its IUPAC name is 8-acetyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | 8-acetyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 152609042 |
| Molecular Formula | C24H24FNO5 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 8-acetyl-N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | CC(=O)C1CCCC2C(=O)C3=C(C=C(C(=O)NCc4ccc(F)cc4)C(=O)C3O)CC12 |
| InChI | InChI=1S/C24H24FNO5/c1-12(27)16-3-2-4-17-18(16)9-14-10-19(22(29)23(30)20(14)21(17)28)24(31)26-11-13-5-7-15(25)8-6-13/h5-8,10,16-18,23,30H,2-4,9,11H2,1H3,(H,26,31) |
| InChIKey | YZCXUSHGNVGNIB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|