C23H23F2NO4 — CID 150447634
(6R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-6-methyl-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 150447634) has the molecular formula C23H23F2NO4 and a molecular weight of 415.44 g/mol. Its IUPAC name is (6R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-6-methyl-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | (6R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-6-methyl-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 150447634 |
| Molecular Formula | C23H23F2NO4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (6R,8aR)-N-[(2,4-difluorophenyl)methyl]-4-hydroxy-6-methyl-3,10-dioxo-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | C[C@@H]1CC[C@@H]2CC3=C(C(=O)C2C1)C(O)C(=O)C(C(=O)NCc1ccc(F)cc1F)=C3 |
| InChI | InChI=1S/C23H23F2NO4/c1-11-2-3-12-7-14-8-17(21(28)22(29)19(14)20(27)16(12)6-11)23(30)26-10-13-4-5-15(24)9-18(13)25/h4-5,8-9,11-12,16,22,29H,2-3,6-7,10H2,1H3,(H,26,30)/t11-,12-,16?,22?/m1/s1 |
| InChIKey | HNCJVEYBYDCHFG-CGTLDIDFSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|