C22H17F2NO4 — CID 58531423
[3-(4-fluorophenoxy)-5-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl formate (PubChem CID 58531423) has the molecular formula C22H17F2NO4 and a molecular weight of 397.38 g/mol. Its IUPAC name is [3-(4-fluorophenoxy)-5-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl formate.
| Compound Name | [3-(4-fluorophenoxy)-5-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl formate |
|---|---|
| PubChem CID | 58531423 |
| Molecular Formula | C22H17F2NO4 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [3-(4-fluorophenoxy)-5-[(4-fluorophenyl)methylcarbamoyl]phenyl]methyl formate |
| SMILES | O=COCc1cc(Oc2ccc(F)cc2)cc(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H17F2NO4/c23-18-3-1-15(2-4-18)12-25-22(27)17-9-16(13-28-14-26)10-21(11-17)29-20-7-5-19(24)6-8-20/h1-11,14H,12-13H2,(H,25,27) |
| InChIKey | RPZRZTPLRUFZPC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|