C22H22N6O3 — CID 58532306
1-[(2-nitrophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine (PubChem CID 58532306) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-[(2-nitrophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(2-nitrophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 58532306 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(2-nitrophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1COn1ccc2ncc(-c3cnn(C4CCNCC4)c3)cc21 |
| InChI | InChI=1S/C22H22N6O3/c29-28(30)21-4-2-1-3-16(21)15-31-27-10-7-20-22(27)11-17(12-24-20)18-13-25-26(14-18)19-5-8-23-9-6-19/h1-4,7,10-14,19,23H,5-6,8-9,15H2 |
| InChIKey | YJTAAFXAPDYOFJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|