C23H22ClFN4O — CID 91027344
1-[(2-chloro-5-fluorophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)indole (PubChem CID 91027344) has the molecular formula C23H22ClFN4O and a molecular weight of 424.91 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)indole.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)indole |
|---|---|
| PubChem CID | 91027344 |
| Molecular Formula | C23H22ClFN4O |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methoxy]-6-(1-piperidin-4-ylpyrazol-4-yl)indole |
| SMILES | Fc1ccc(Cl)c(COn2ccc3ccc(-c4cnn(C5CCNCC5)c4)cc32)c1 |
| InChI | InChI=1S/C23H22ClFN4O/c24-22-4-3-20(25)11-18(22)15-30-29-10-7-16-1-2-17(12-23(16)29)19-13-27-28(14-19)21-5-8-26-9-6-21/h1-4,7,10-14,21,26H,5-6,8-9,15H2 |
| InChIKey | GGCNGYACKYMKOL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |