C24H25F3N8O2 — CID 58532667
(2R)-3,3,3-trifluoro-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-2-phenylpropan-1-one (PubChem CID 58532667) has the molecular formula C24H25F3N8O2 and a molecular weight of 514.51 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-2-phenylpropan-1-one.
| Compound Name | (2R)-3,3,3-trifluoro-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 58532667 |
| Molecular Formula | C24H25F3N8O2 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-1-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-2-phenylpropan-1-one |
| SMILES | CO[C@@](C(=O)N1CCN(c2nc(Nc3cc(C)[nH]n3)c3cccn3n2)CC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H25F3N8O2/c1-16-15-19(31-30-16)28-20-18-9-6-10-35(18)32-22(29-20)34-13-11-33(12-14-34)21(36)23(37-2,24(25,26)27)17-7-4-3-5-8-17/h3-10,15H,11-14H2,1-2H3,(H2,28,29,30,31,32)/t23-/m1/s1 |
| InChIKey | CLCXYXQSNQHNTE-HSZRJFAPSA-N |
| XLogP | 3.26 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |