C19H21Y- — CID 58534635
1-methyl-4-(1-phenylcyclohexyl)benzene;yttrium (PubChem CID 58534635) has the molecular formula C19H21Y- and a molecular weight of 338.28 g/mol. Its IUPAC name is 1-methyl-4-(1-phenylcyclohexyl)benzene;yttrium.
| Compound Name | 1-methyl-4-(1-phenylcyclohexyl)benzene;yttrium |
|---|---|
| PubChem CID | 58534635 |
| Molecular Formula | C19H21Y- |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-methyl-4-(1-phenylcyclohexyl)benzene;yttrium |
| SMILES | Cc1ccc(C2(c3cc[c-]cc3)CCCCC2)cc1.[Y] |
| InChI | InChI=1S/C19H21.Y/c1-16-10-12-18(13-11-16)19(14-6-3-7-15-19)17-8-4-2-5-9-17;/h4-5,8-13H,3,6-7,14-15H2,1H3;/q-1; |
| InChIKey | VVSGKUNJNOVNHL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|