C20H23F3O2 — CID 585354
2-(1-adamantyl)ethyl 2-(trifluoromethyl)benzoate (PubChem CID 585354) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-(1-adamantyl)ethyl 2-(trifluoromethyl)benzoate.
| Compound Name | 2-(1-adamantyl)ethyl 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 585354 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(1-adamantyl)ethyl 2-(trifluoromethyl)benzoate |
| SMILES | O=C(OCCC12CC3CC(CC(C3)C1)C2)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H23F3O2/c21-20(22,23)17-4-2-1-3-16(17)18(24)25-6-5-19-10-13-7-14(11-19)9-15(8-13)12-19/h1-4,13-15H,5-12H2 |
| InChIKey | ZQANPYWLMPXMMA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |