C14H20O3S — CID 58536872
(3R,4S,6S)-2-ethyl-4-methyl-6-phenylsulfanyloxane-3,5-diol (PubChem CID 58536872) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (3R,4S,6S)-2-ethyl-4-methyl-6-phenylsulfanyloxane-3,5-diol.
| Compound Name | (3R,4S,6S)-2-ethyl-4-methyl-6-phenylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 58536872 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3R,4S,6S)-2-ethyl-4-methyl-6-phenylsulfanyloxane-3,5-diol |
| SMILES | CCC1O[C@@H](Sc2ccccc2)C(O)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C14H20O3S/c1-3-11-12(15)9(2)13(16)14(17-11)18-10-7-5-4-6-8-10/h4-9,11-16H,3H2,1-2H3/t9-,11?,12+,13?,14-/m0/s1 |
| InChIKey | SKPUQJGFSXDNRJ-KWLOYBESSA-N |
| XLogP | 2.27 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |