C13H18O4S — CID 58536879
(3R,4S,6S)-2-ethyl-6-phenylsulfanyloxane-3,4,5-triol (PubChem CID 58536879) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (3R,4S,6S)-2-ethyl-6-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (3R,4S,6S)-2-ethyl-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 58536879 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3R,4S,6S)-2-ethyl-6-phenylsulfanyloxane-3,4,5-triol |
| SMILES | CCC1O[C@@H](Sc2ccccc2)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18O4S/c1-2-9-10(14)11(15)12(16)13(17-9)18-8-6-4-3-5-7-8/h3-7,9-16H,2H2,1H3/t9?,10-,11-,12?,13-/m0/s1 |
| InChIKey | OQHVEYBHIKEMHA-IJTJVXSJSA-N |
| XLogP | 1.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |