About copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one
copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one (PubChem CID 58537801) has the molecular formula C6H10CuO2
and a molecular weight of 177.69 g/mol. Its IUPAC name is copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one.
Molecular Properties
| Compound Name | copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one |
| PubChem CID | 58537801 |
| Molecular Formula | C6H10CuO2 |
| Molecular Weight | 177.69 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one |
| SMILES | CC(=O)/C(C)=C(/C)O.[Cu] |
| InChI | InChI=1S/C6H10O2.Cu/c1-4(5(2)7)6(3)8;/h7H,1-3H3;/b5-4-; |
| InChIKey | DEJCBBOJWQGWJW-MKWAYWHRSA-N |
| XLogP | 1.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.69 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one?
The IUPAC name of copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one (CID 58537801) is copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one.
What is the SMILES notation for copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one?
The canonical SMILES for copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one is CC(=O)/C(C)=C(/C)O.[Cu].
What is the InChIKey of copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one?
The InChIKey is DEJCBBOJWQGWJW-MKWAYWHRSA-N. The full InChI is InChI=1S/C6H10O2.Cu/c1-4(5(2)7)6(3)8;/h7H,1-3H3;/b5-4-;.
What are the key properties of copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one?
copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one has a molecular weight of 177.69 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-4-hydroxy-3-methylpent-3-en-2-one is sourced from PubChem (CID 58537801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).