C12H14N2Y-2 — CID 58546858
7-methyl-2H-1,5-naphthyridin-2-ide;propane;yttrium (PubChem CID 58546858) has the molecular formula C12H14N2Y-2 and a molecular weight of 275.16 g/mol. Its IUPAC name is 7-methyl-2H-1,5-naphthyridin-2-ide;propane;yttrium.
| Compound Name | 7-methyl-2H-1,5-naphthyridin-2-ide;propane;yttrium |
|---|---|
| PubChem CID | 58546858 |
| Molecular Formula | C12H14N2Y-2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 7-methyl-2H-1,5-naphthyridin-2-ide;propane;yttrium |
| SMILES | C[CH-]C.Cc1cnc2cc[c-]nc2c1.[Y] |
| InChI | InChI=1S/C9H7N2.C3H7.Y/c1-7-5-9-8(11-6-7)3-2-4-10-9;1-3-2;/h2-3,5-6H,1H3;3H,1-2H3;/q2*-1; |
| InChIKey | FWFARNJVQQLDQJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|