C26H25N5O3S — CID 58547400
4-[4-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]sulfonylmorpholine (PubChem CID 58547400) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is 4-[4-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 58547400 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 4-[4-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(-c2nccnc2C2CN(c3ccc4ccccc4n3)C2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H25N5O3S/c32-35(33,31-13-15-34-16-14-31)22-8-5-20(6-9-22)25-26(28-12-11-27-25)21-17-30(18-21)24-10-7-19-3-1-2-4-23(19)29-24/h1-12,21H,13-18H2 |
| InChIKey | FXEJNTQCRJEKKU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |