C27H24N4O — CID 58547295
2-cyclopropyl-1-[3-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]ethanone (PubChem CID 58547295) has the molecular formula C27H24N4O and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-cyclopropyl-1-[3-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]ethanone.
| Compound Name | 2-cyclopropyl-1-[3-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58547295 |
| Molecular Formula | C27H24N4O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-cyclopropyl-1-[3-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]phenyl]ethanone |
| SMILES | O=C(CC1CC1)c1cccc(-c2nccnc2C2CN(c3ccc4ccccc4n3)C2)c1 |
| InChI | InChI=1S/C27H24N4O/c32-24(14-18-8-9-18)20-5-3-6-21(15-20)26-27(29-13-12-28-26)22-16-31(17-22)25-11-10-19-4-1-2-7-23(19)30-25/h1-7,10-13,15,18,22H,8-9,14,16-17H2 |
| InChIKey | HJORAXKVEBNOQT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |