C25H22N4O2 — CID 58547658
1-[5-(3-methoxyphenyl)-6-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]ethanone (PubChem CID 58547658) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[5-(3-methoxyphenyl)-6-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]ethanone.
| Compound Name | 1-[5-(3-methoxyphenyl)-6-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 58547658 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[5-(3-methoxyphenyl)-6-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]ethanone |
| SMILES | COc1cccc(-c2ncc(C(C)=O)nc2C2CN(c3ccc4ccccc4n3)C2)c1 |
| InChI | InChI=1S/C25H22N4O2/c1-16(30)22-13-26-24(18-7-5-8-20(12-18)31-2)25(28-22)19-14-29(15-19)23-11-10-17-6-3-4-9-21(17)27-23/h3-13,19H,14-15H2,1-2H3 |
| InChIKey | RPKDCZSNOQWIGL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |