C23H18FN5O — CID 58547374
2-fluoro-5-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]benzamide (PubChem CID 58547374) has the molecular formula C23H18FN5O and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-fluoro-5-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]benzamide.
| Compound Name | 2-fluoro-5-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 58547374 |
| Molecular Formula | C23H18FN5O |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-fluoro-5-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]benzamide |
| SMILES | NC(=O)c1cc(-c2nccnc2C2CN(c3ccc4ccccc4n3)C2)ccc1F |
| InChI | InChI=1S/C23H18FN5O/c24-18-7-5-15(11-17(18)23(25)30)21-22(27-10-9-26-21)16-12-29(13-16)20-8-6-14-3-1-2-4-19(14)28-20/h1-11,16H,12-13H2,(H2,25,30) |
| InChIKey | NHADAXUUDLCIRH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |