C21H27N7O2 — CID 58548848
3-[[2-[[1-(4-isocyanocyclohexyl)azetidin-3-yl]amino]-2-oxoethyl]amino]-5-methylindazole-1-carboxamide (PubChem CID 58548848) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[[2-[[1-(4-isocyanocyclohexyl)azetidin-3-yl]amino]-2-oxoethyl]amino]-5-methylindazole-1-carboxamide.
| Compound Name | 3-[[2-[[1-(4-isocyanocyclohexyl)azetidin-3-yl]amino]-2-oxoethyl]amino]-5-methylindazole-1-carboxamide |
|---|---|
| PubChem CID | 58548848 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-[[2-[[1-(4-isocyanocyclohexyl)azetidin-3-yl]amino]-2-oxoethyl]amino]-5-methylindazole-1-carboxamide |
| SMILES | [C-]#[N+]C1CCC(N2CC(NC(=O)CNc3nn(C(N)=O)c4ccc(C)cc34)C2)CC1 |
| InChI | InChI=1S/C21H27N7O2/c1-13-3-8-18-17(9-13)20(26-28(18)21(22)30)24-10-19(29)25-15-11-27(12-15)16-6-4-14(23-2)5-7-16/h3,8-9,14-16H,4-7,10-12H2,1H3,(H2,22,30)(H,24,26)(H,25,29) |
| InChIKey | ZJVQBJXGTYARFD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|