C33H45N3O — CID 58549077
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(methylaminomethyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 58549077) has the molecular formula C33H45N3O and a molecular weight of 499.74 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(methylaminomethyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(methylaminomethyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549077 |
| Molecular Formula | C33H45N3O |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.36 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(methylaminomethyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | CNCc1cccc2c1CCC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C33H45N3O/c1-34-21-27-14-8-16-29-28(27)15-9-18-33(29)23-35-22-30(33)32(37)36-19-17-26(24-10-4-2-5-11-24)20-31(36)25-12-6-3-7-13-25/h2,4-5,8,10-11,14,16,25-26,30-31,34-35H,3,6-7,9,12-13,15,17-23H2,1H3/t26-,30+,31+,33+/m1/s1 |
| InChIKey | YRLFHMVVSSVTSM-JGNJWOLJSA-N |
| XLogP | 5.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |