C31H42N3O2+ — CID 123875864
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 123875864) has the molecular formula C31H42N3O2+ and a molecular weight of 488.70 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 123875864 |
| Molecular Formula | C31H42N3O2+ |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | COc1ccc2c([nH+]1)CCC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C31H41N3O2/c1-36-29-15-14-25-27(33-29)13-8-17-31(25)21-32-20-26(31)30(35)34-18-16-24(22-9-4-2-5-10-22)19-28(34)23-11-6-3-7-12-23/h2,4-5,9-10,14-15,23-24,26,28,32H,3,6-8,11-13,16-21H2,1H3/p+1/t24-,26+,28+,31+/m1/s1 |
| InChIKey | WMHJQYLAMRLMCO-OUSABNGFSA-O |
| XLogP | 4.66 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |