C32H44N3O3+ — CID 123823219
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(5R)-2,8-dimethoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 123823219) has the molecular formula C32H44N3O3+ and a molecular weight of 518.72 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(5R)-2,8-dimethoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(5R)-2,8-dimethoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 123823219 |
| Molecular Formula | C32H44N3O3+ |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(5R)-2,8-dimethoxyspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | COc1ccc2c([nH+]1)C(OC)CC[C@]21CNCC1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C32H43N3O3/c1-37-28-15-17-32(25-13-14-29(38-2)34-30(25)28)21-33-20-26(32)31(36)35-18-16-24(22-9-5-3-6-10-22)19-27(35)23-11-7-4-8-12-23/h3,5-6,9-10,13-14,23-24,26-28,33H,4,7-8,11-12,15-21H2,1-2H3/p+1/t24-,26?,27+,28?,32+/m1/s1 |
| InChIKey | XJVHWKVSMTWTPS-WLMPJADTSA-O |
| XLogP | 4.80 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |