C33H41F2N2O2+ — CID 58549380
[(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,6R)-spiro[3,7,8,9-tetrahydro-2H-benzo[g][1]benzofuran-6,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549380) has the molecular formula C33H41F2N2O2+ and a molecular weight of 535.70 g/mol. Its IUPAC name is [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,6R)-spiro[3,7,8,9-tetrahydro-2H-benzo[g][1]benzofuran-6,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,6R)-spiro[3,7,8,9-tetrahydro-2H-benzo[g][1]benzofuran-6,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549380 |
| Molecular Formula | C33H41F2N2O2+ |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [(2S,4R)-2-(3,3-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,6R)-spiro[3,7,8,9-tetrahydro-2H-benzo[g][1]benzofuran-6,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | O=C([C@@H]1C[NH2+]C[C@]12CCCc1c2ccc2c1OCC2)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C33H40F2N2O2/c34-33(35)15-4-8-25(19-33)29-18-24(22-6-2-1-3-7-22)12-16-37(29)31(38)28-20-36-21-32(28)14-5-9-26-27(32)11-10-23-13-17-39-30(23)26/h1-3,6-7,10-11,24-25,28-29,36H,4-5,8-9,12-21H2/p+1/t24-,25?,28+,29+,32+/m1/s1 |
| InChIKey | PJDXOOLMTHQFCD-MYPPNGETSA-O |
| XLogP | 4.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |