C31H41Cl2F2N3O — CID 160606080
[(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride (PubChem CID 160606080) has the molecular formula C31H41Cl2F2N3O and a molecular weight of 580.59 g/mol. Its IUPAC name is [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride.
| Compound Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
|---|---|
| PubChem CID | 160606080 |
| Molecular Formula | C31H41Cl2F2N3O |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,5R)-2-methylspiro[7,8-dihydro-6H-quinolin-1-ium-5,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
| SMILES | Cc1ccc2c([nH+]1)CCC[C@]21C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCC(F)(F)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C31H39F2N3O.2ClH/c1-21-9-10-25-27(35-21)8-5-14-30(25)20-34-19-26(30)29(37)36-17-13-24(22-6-3-2-4-7-22)18-28(36)23-11-15-31(32,33)16-12-23;;/h2-4,6-7,9-10,23-24,26,28,34H,5,8,11-20H2,1H3;2*1H/t24-,26+,28+,30+;;/m1../s1 |
| InChIKey | GLTLKQMPCITPPD-LZDOSDPCSA-N |
| XLogP | -1.82 |
| TPSA | 51.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |