C29H41Cl2N3OS — CID 159999047
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-2-methylspiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride (PubChem CID 159999047) has the molecular formula C29H41Cl2N3OS and a molecular weight of 550.64 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-2-methylspiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-2-methylspiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
|---|---|
| PubChem CID | 159999047 |
| Molecular Formula | C29H41Cl2N3OS |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-2-methylspiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
| SMILES | Cc1[nH+]c2c(s1)[C@]1(CCC2)C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C29H39N3OS.2ClH/c1-20-31-25-13-8-15-29(27(25)34-20)19-30-18-24(29)28(33)32-16-14-23(21-9-4-2-5-10-21)17-26(32)22-11-6-3-7-12-22;;/h2,4-5,9-10,22-24,26,30H,3,6-8,11-19H2,1H3;2*1H/t23-,24+,26+,29-;;/m1../s1 |
| InChIKey | YSPCHNOKJSAMJA-GGGOAUOHSA-N |
| XLogP | -2.00 |
| TPSA | 51.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |