C28H39Cl2N3OS — CID 160540751
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-spiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride (PubChem CID 160540751) has the molecular formula C28H39Cl2N3OS and a molecular weight of 536.61 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-spiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-spiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
|---|---|
| PubChem CID | 160540751 |
| Molecular Formula | C28H39Cl2N3OS |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,7S)-spiro[5,6-dihydro-4H-1,3-benzothiazol-3-ium-7,4'-pyrrolidin-1-ium]-3'-yl]methanone dichloride |
| SMILES | O=C([C@@H]1C[NH2+]C[C@]12CCCc1[nH+]csc12)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C28H37N3OS.2ClH/c32-27(23-17-29-18-28(23)14-7-12-24-26(28)33-19-30-24)31-15-13-22(20-8-3-1-4-9-20)16-25(31)21-10-5-2-6-11-21;;/h1,3-4,8-9,19,21-23,25,29H,2,5-7,10-18H2;2*1H/t22-,23+,25+,28-;;/m1../s1 |
| InChIKey | XPHOTPUHXGESSR-OGGHXYTOSA-N |
| XLogP | -2.31 |
| TPSA | 51.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |