C29H42N4O+2 — CID 58549483
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,8S)-2-methylspiro[1,5,6,7-tetrahydroimidazo[1,2-a]pyridin-4-ium-8,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549483) has the molecular formula C29H42N4O+2 and a molecular weight of 462.68 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,8S)-2-methylspiro[1,5,6,7-tetrahydroimidazo[1,2-a]pyridin-4-ium-8,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,8S)-2-methylspiro[1,5,6,7-tetrahydroimidazo[1,2-a]pyridin-4-ium-8,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549483 |
| Molecular Formula | C29H42N4O+2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,8S)-2-methylspiro[1,5,6,7-tetrahydroimidazo[1,2-a]pyridin-4-ium-8,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | Cc1c[n+]2c([nH]1)[C@]1(CCC2)C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C29H40N4O/c1-21-19-32-15-8-14-29(28(32)31-21)20-30-18-25(29)27(34)33-16-13-24(22-9-4-2-5-10-22)17-26(33)23-11-6-3-7-12-23/h2,4-5,9-10,19,23-26,30H,3,6-8,11-18,20H2,1H3/p+2/t24-,25+,26+,29-/m1/s1 |
| InChIKey | UGADJKPQYZMOPX-DAMQTCOWSA-P |
| XLogP | 3.19 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|