C31H43N3O2+2 — CID 58549394
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549394) has the molecular formula C31H43N3O2+2 and a molecular weight of 489.70 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549394 |
| Molecular Formula | C31H43N3O2+2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | COc1cccc2c1C[NH2+]C[C@]21C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C31H41N3O2/c1-36-29-14-8-13-26-25(29)18-32-20-31(26)21-33-19-27(31)30(35)34-16-15-24(22-9-4-2-5-10-22)17-28(34)23-11-6-3-7-12-23/h2,4-5,8-10,13-14,23-24,27-28,32-33H,3,6-7,11-12,15-21H2,1H3/p+2/t24-,27+,28+,31+/m1/s1 |
| InChIKey | GXABIIGKUCFAFD-YBXPBZDNSA-P |
| XLogP | 2.56 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |