C32H42F3N3O2+2 — CID 58549133
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549133) has the molecular formula C32H42F3N3O2+2 and a molecular weight of 557.70 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549133 |
| Molecular Formula | C32H42F3N3O2+2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinolin-2-ium-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | O=C([C@@H]1C[NH2+]C[C@]12C[NH2+]Cc1c(OCC(F)(F)F)cccc12)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C32H40F3N3O2/c33-32(34,35)21-40-29-13-7-12-26-25(29)17-36-19-31(26)20-37-18-27(31)30(39)38-15-14-24(22-8-3-1-4-9-22)16-28(38)23-10-5-2-6-11-23/h1,3-4,7-9,12-13,23-24,27-28,36-37H,2,5-6,10-11,14-21H2/p+2/t24-,27+,28+,31+/m1/s1 |
| InChIKey | VJWSYXYJGMYECL-YBXPBZDNSA-P |
| XLogP | 3.49 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |