C31H43ClN2O2 — CID 162244661
[(3'S,4R)-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone chloride (PubChem CID 162244661) has the molecular formula C31H43ClN2O2 and a molecular weight of 511.15 g/mol. Its IUPAC name is [(3'S,4R)-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone chloride.
| Compound Name | [(3'S,4R)-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone chloride |
|---|---|
| PubChem CID | 162244661 |
| Molecular Formula | C31H43ClN2O2 |
| Molecular Weight | 511.15 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [(3'S,4R)-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidin-1-ium]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone chloride |
| SMILES | CCC(CC)[C@@H]1C[C@H](c2ccccc2)CCN1C(=O)[C@@H]1C[NH2+]C[C@]12CCCc1c(OC)cccc12.[Cl-] |
| InChI | InChI=1S/C31H42N2O2.ClH/c1-4-22(5-2)28-19-24(23-11-7-6-8-12-23)16-18-33(28)30(34)27-20-32-21-31(27)17-10-13-25-26(31)14-9-15-29(25)35-3;/h6-9,11-12,14-15,22,24,27-28,32H,4-5,10,13,16-21H2,1-3H3;1H/t24-,27+,28+,31+;/m1./s1 |
| InChIKey | MLILWTMRCSRSOG-TWAJCMMJSA-N |
| XLogP | 1.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |