C28H42N4OS — CID 123886829
[(3'S,7S)-2-(methylamino)spiro[3,4,5,6-tetrahydro-2H-1,3-benzothiazole-7,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone (PubChem CID 123886829) has the molecular formula C28H42N4OS and a molecular weight of 482.74 g/mol. Its IUPAC name is [(3'S,7S)-2-(methylamino)spiro[3,4,5,6-tetrahydro-2H-1,3-benzothiazole-7,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone.
| Compound Name | [(3'S,7S)-2-(methylamino)spiro[3,4,5,6-tetrahydro-2H-1,3-benzothiazole-7,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123886829 |
| Molecular Formula | C28H42N4OS |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | [(3'S,7S)-2-(methylamino)spiro[3,4,5,6-tetrahydro-2H-1,3-benzothiazole-7,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2-pentan-3-yl-4-phenylpiperidin-1-yl]methanone |
| SMILES | CCC(CC)[C@@H]1C[C@H](c2ccccc2)CCN1C(=O)[C@@H]1CNC[C@]12CCCC1=C2SC(NC)N1 |
| InChI | InChI=1S/C28H42N4OS/c1-4-19(5-2)24-16-21(20-10-7-6-8-11-20)13-15-32(24)26(33)22-17-30-18-28(22)14-9-12-23-25(28)34-27(29-3)31-23/h6-8,10-11,19,21-22,24,27,29-31H,4-5,9,12-18H2,1-3H3/t21-,22+,24+,27?,28-/m1/s1 |
| InChIKey | LYZXSYUPUVFVME-JDZGGLLMSA-N |
| XLogP | 4.64 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |