C30H32ClN3O — CID 58549231
[(3'S,8S)-2-chlorospiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2,4-diphenylpiperidin-1-yl]methanone (PubChem CID 58549231) has the molecular formula C30H32ClN3O and a molecular weight of 486.06 g/mol. Its IUPAC name is [(3'S,8S)-2-chlorospiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2,4-diphenylpiperidin-1-yl]methanone.
| Compound Name | [(3'S,8S)-2-chlorospiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2,4-diphenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58549231 |
| Molecular Formula | C30H32ClN3O |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(3'S,8S)-2-chlorospiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]-[(2S,4R)-2,4-diphenylpiperidin-1-yl]methanone |
| SMILES | O=C([C@@H]1CNC[C@]12CCCc1ccc(Cl)nc12)N1CC[C@@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H32ClN3O/c31-27-14-13-23-12-7-16-30(28(23)33-27)20-32-19-25(30)29(35)34-17-15-24(21-8-3-1-4-9-21)18-26(34)22-10-5-2-6-11-22/h1-6,8-11,13-14,24-26,32H,7,12,15-20H2/t24-,25+,26+,30-/m1/s1 |
| InChIKey | QJGQWLMFTOABQZ-NHICWYPXSA-N |
| XLogP | 5.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|