C36H37N3O — CID 58549032
[(2S,4R)-2,4-diphenylpiperidin-1-yl]-[(3'S,8S)-2-phenylspiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 58549032) has the molecular formula C36H37N3O and a molecular weight of 527.71 g/mol. Its IUPAC name is [(2S,4R)-2,4-diphenylpiperidin-1-yl]-[(3'S,8S)-2-phenylspiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2,4-diphenylpiperidin-1-yl]-[(3'S,8S)-2-phenylspiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549032 |
| Molecular Formula | C36H37N3O |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | [(2S,4R)-2,4-diphenylpiperidin-1-yl]-[(3'S,8S)-2-phenylspiro[6,7-dihydro-5H-quinoline-8,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | O=C([C@@H]1CNC[C@]12CCCc1ccc(-c3ccccc3)nc12)N1CC[C@@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C36H37N3O/c40-35(39-22-20-30(26-11-4-1-5-12-26)23-33(39)28-15-8-3-9-16-28)31-24-37-25-36(31)21-10-17-29-18-19-32(38-34(29)36)27-13-6-2-7-14-27/h1-9,11-16,18-19,30-31,33,37H,10,17,20-25H2/t30-,31+,33+,36-/m1/s1 |
| InChIKey | MJNBEHAJWDGXAT-OPJRRXFGSA-N |
| XLogP | 6.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |