C31H40F2N2O2 — CID 58549707
[(3'S,4R)-5-fluoro-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-(2-fluorophenyl)-2-pentan-3-ylpiperidin-1-yl]methanone (PubChem CID 58549707) has the molecular formula C31H40F2N2O2 and a molecular weight of 510.67 g/mol. Its IUPAC name is [(3'S,4R)-5-fluoro-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-(2-fluorophenyl)-2-pentan-3-ylpiperidin-1-yl]methanone.
| Compound Name | [(3'S,4R)-5-fluoro-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-(2-fluorophenyl)-2-pentan-3-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58549707 |
| Molecular Formula | C31H40F2N2O2 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | [(3'S,4R)-5-fluoro-8-methoxyspiro[2,3-dihydro-1H-naphthalene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-(2-fluorophenyl)-2-pentan-3-ylpiperidin-1-yl]methanone |
| SMILES | CCC(CC)[C@@H]1C[C@H](c2ccccc2F)CCN1C(=O)[C@@H]1CNC[C@]12CCCc1c(OC)ccc(F)c12 |
| InChI | InChI=1S/C31H40F2N2O2/c1-4-20(5-2)27-17-21(22-9-6-7-11-25(22)32)14-16-35(27)30(36)24-18-34-19-31(24)15-8-10-23-28(37-3)13-12-26(33)29(23)31/h6-7,9,11-13,20-21,24,27,34H,4-5,8,10,14-19H2,1-3H3/t21-,24+,27+,31-/m1/s1 |
| InChIKey | QPNOKRBYMCDPHZ-IZUVBJGOSA-N |
| XLogP | 5.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |